C35H33BrN4O2 — CID 135879773
1-[(12E)-18-bromo-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone (PubChem CID 135879773) has the molecular formula C35H33BrN4O2 and a molecular weight of 621.58 g/mol. Its IUPAC name is 1-[(12E)-18-bromo-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone.
| Compound Name | 1-[(12E)-18-bromo-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 135879773 |
| Molecular Formula | C35H33BrN4O2 |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 1-[(12E)-18-bromo-12-(1-hydroxyethylidene)-7,7-dimethyl-15-(2,4,6-trimethylphenyl)-8,22-dihydroporphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=CC2=N/C1=C\C1=N/C(=C(/c3c(C)cc(C)cc3C)C3=C/C(=C(/C)O)C(=N3)/C=C3/CC(C)(C)/C(=C/2)N3)C=C1Br |
| InChI | InChI=1S/C35H33BrN4O2/c1-17-8-18(2)33(19(3)9-17)34-30-13-25(21(5)42)27(39-30)11-23-16-35(6,7)32(38-23)12-22-10-24(20(4)41)28(37-22)15-29-26(36)14-31(34)40-29/h8-15,38,42H,16H2,1-7H3/b23-11-,25-21+,28-15-,32-12-,34-31+ |
| InChIKey | UUUORHQLRVFSTK-XKYDYCBISA-N |
| XLogP | 7.88 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|