C18H14N4OS2 — CID 135920587
(2Z)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol (PubChem CID 135920587) has the molecular formula C18H14N4OS2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (2Z)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol.
| Compound Name | (2Z)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 135920587 |
| Molecular Formula | C18H14N4OS2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (2Z)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-4-ol |
| SMILES | C=CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N\c1nccs1 |
| InChI | InChI=1S/C18H14N4OS2/c1-2-8-22-16(23)15(25-18(22)21-17-19-7-9-24-17)10-12-11-20-14-6-4-3-5-13(12)14/h2-7,9-11,23H,1,8H2/b12-10+,21-18- |
| InChIKey | CSEYRTWVWBHOAE-RTHZARDRSA-N |
| XLogP | 4.39 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|