C13H15N5OS2 — CID 135928291
N'-[(Z)-[2-oxo-4-(4-propan-2-ylpyridin-1-ium-1-yl)-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate (PubChem CID 135928291) has the molecular formula C13H15N5OS2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N'-[(Z)-[2-oxo-4-(4-propan-2-ylpyridin-1-ium-1-yl)-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate.
| Compound Name | N'-[(Z)-[2-oxo-4-(4-propan-2-ylpyridin-1-ium-1-yl)-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 135928291 |
| Molecular Formula | C13H15N5OS2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N'-[(Z)-[2-oxo-4-(4-propan-2-ylpyridin-1-ium-1-yl)-3H-1,3-thiazol-5-yl]methylideneamino]carbamimidothioate |
| SMILES | CC(C)c1cc[n+](-c2[nH]c(=O)sc2/C=N\N=C(\N)[S-])cc1 |
| InChI | InChI=1S/C13H15N5OS2/c1-8(2)9-3-5-18(6-4-9)11-10(21-13(19)16-11)7-15-17-12(14)20/h3-8H,1-2H3,(H3-,14,15,16,17,19,20) |
| InChIKey | AXTGXTTUJJFSFZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|