C18H22O — CID 135931878
(2S,3R)-2-[(Z)-2-ethynyloct-1-enyl]-3-phenyloxirane (PubChem CID 135931878) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (2S,3R)-2-[(Z)-2-ethynyloct-1-enyl]-3-phenyloxirane.
| Compound Name | (2S,3R)-2-[(Z)-2-ethynyloct-1-enyl]-3-phenyloxirane |
|---|---|
| PubChem CID | 135931878 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (2S,3R)-2-[(Z)-2-ethynyloct-1-enyl]-3-phenyloxirane |
| SMILES | C#C/C(=C\[C@@H]1O[C@@H]1c1ccccc1)CCCCCC |
| InChI | InChI=1S/C18H22O/c1-3-5-6-8-11-15(4-2)14-17-18(19-17)16-12-9-7-10-13-16/h2,7,9-10,12-14,17-18H,3,5-6,8,11H2,1H3/b15-14+/t17-,18+/m0/s1 |
| InChIKey | DZUKJWQISFJSNW-KRWOKUGFSA-N |
| XLogP | 4.66 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|