C17H27N5O4S2 — CID 135937256
5-[(3R)-dithiolan-3-yl]pentanoic acid;2-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]guanidine (PubChem CID 135937256) has the molecular formula C17H27N5O4S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]pentanoic acid;2-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]guanidine.
| Compound Name | 5-[(3R)-dithiolan-3-yl]pentanoic acid;2-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 135937256 |
| Molecular Formula | C17H27N5O4S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]pentanoic acid;2-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]guanidine |
| SMILES | Cc1ncc(CO)c(/C=N/N=C(N)N)c1O.O=C(O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C9H13N5O2.C8H14O2S2/c1-5-8(16)7(3-13-14-9(10)11)6(4-15)2-12-5;9-8(10)4-2-1-3-7-5-6-11-12-7/h2-3,15-16H,4H2,1H3,(H4,10,11,14);7H,1-6H2,(H,9,10)/b13-3+;/t;7-/m.1/s1 |
| InChIKey | FEEMNAJNYWBSBD-HGTMSKGVSA-N |
| XLogP | 1.98 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|