C18H19I2NO2 — CID 135952342
2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol (PubChem CID 135952342) has the molecular formula C18H19I2NO2 and a molecular weight of 535.16 g/mol. Its IUPAC name is 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 135952342 |
| Molecular Formula | C18H19I2NO2 |
| Molecular Weight | 535.16 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol |
| SMILES | CC[C@H](O)[C@H](Cc1ccccc1)/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C18H19I2NO2/c1-2-17(22)16(8-12-6-4-3-5-7-12)21-11-13-9-14(19)10-15(20)18(13)23/h3-7,9-11,16-17,22-23H,2,8H2,1H3/b21-11+/t16-,17-/m0/s1 |
| InChIKey | HPHOBTNYSICPCH-LXGRAFHKSA-N |
| XLogP | 4.40 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|