About 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol
2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol (PubChem CID 135952342) has the molecular formula C18H19I2NO2
and a molecular weight of 535.16 g/mol. Its IUPAC name is 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol.
Molecular Properties
| Compound Name | 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol |
| PubChem CID | 135952342 |
| Molecular Formula | C18H19I2NO2 |
| Molecular Weight | 535.16 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol |
| SMILES | CC[C@H](O)[C@H](Cc1ccccc1)/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C18H19I2NO2/c1-2-17(22)16(8-12-6-4-3-5-7-12)21-11-13-9-14(19)10-15(20)18(13)23/h3-7,9-11,16-17,22-23H,2,8H2,1H3/b21-11+/t16-,17-/m0/s1 |
| InChIKey | HPHOBTNYSICPCH-LXGRAFHKSA-N |
| XLogP | 4.40 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol?
The IUPAC name of 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol (CID 135952342) is 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol.
What is the SMILES notation for 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol?
The canonical SMILES for 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol is CC[C@H](O)[C@H](Cc1ccccc1)/N=C/c1cc(I)cc(I)c1O.
What is the InChIKey of 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol?
The InChIKey is HPHOBTNYSICPCH-LXGRAFHKSA-N. The full InChI is InChI=1S/C18H19I2NO2/c1-2-17(22)16(8-12-6-4-3-5-7-12)21-11-13-9-14(19)10-15(20)18(13)23/h3-7,9-11,16-17,22-23H,2,8H2,1H3/b21-11+/t16-,17-/m0/s1.
What are the key properties of 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol?
2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol has a molecular weight of 535.16 g/mol, XLogP of 4.40, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S,3S)-3-hydroxy-1-phenylpentan-2-yl]iminomethyl]-4,6-diiodophenol is sourced from PubChem (CID 135952342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).