About propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate
propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate (PubChem CID 135956241) has the molecular formula C23H22N2O5
and a molecular weight of 406.44 g/mol. Its IUPAC name is propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate |
| PubChem CID | 135956241 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate |
| SMILES | COc1ccc(C(=O)/N=C2\N=C(/C(C(=O)OC(C)C)=C(\C)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-13(2)30-23(28)19(14(3)26)20-17-7-5-6-8-18(17)21(24-20)25-22(27)15-9-11-16(29-4)12-10-15/h5-13,26H,1-4H3/b19-14-,25-21- |
| InChIKey | GGNWLXMMIOIKFU-ATQQDBMQSA-N |
| XLogP | 3.87 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate?
The IUPAC name of propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate (CID 135956241) is propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate.
What is the SMILES notation for propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate?
The canonical SMILES for propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate is COc1ccc(C(=O)/N=C2\N=C(/C(C(=O)OC(C)C)=C(\C)O)c3ccccc32)cc1.
What is the InChIKey of propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate?
The InChIKey is GGNWLXMMIOIKFU-ATQQDBMQSA-N. The full InChI is InChI=1S/C23H22N2O5/c1-13(2)30-23(28)19(14(3)26)20-17-7-5-6-8-18(17)21(24-20)25-22(27)15-9-11-16(29-4)12-10-15/h5-13,26H,1-4H3/b19-14-,25-21-.
What are the key properties of propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate?
propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate has a molecular weight of 406.44 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (Z)-3-hydroxy-2-[3-(4-methoxybenzoyl)iminoisoindol-1-yl]but-2-enoate is sourced from PubChem (CID 135956241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).