C23H22N2O7 — CID 136833662
methyl 3-hydroxy-2-[3-(3,4,5-trimethoxybenzoyl)iminoisoindol-1-yl]but-2-enoate (PubChem CID 136833662) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[3-(3,4,5-trimethoxybenzoyl)iminoisoindol-1-yl]but-2-enoate.
| Compound Name | methyl 3-hydroxy-2-[3-(3,4,5-trimethoxybenzoyl)iminoisoindol-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 136833662 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | methyl 3-hydroxy-2-[3-(3,4,5-trimethoxybenzoyl)iminoisoindol-1-yl]but-2-enoate |
| SMILES | COC(=O)C(C1=N/C(=N\C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccc21)=C(C)O |
| InChI | InChI=1S/C23H22N2O7/c1-12(26)18(23(28)32-5)19-14-8-6-7-9-15(14)21(24-19)25-22(27)13-10-16(29-2)20(31-4)17(11-13)30-3/h6-11,26H,1-5H3/b18-12?,25-21- |
| InChIKey | UUVGRRTWMPWFMA-YPCMFJALSA-N |
| XLogP | 3.11 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|