C14H8N2O2S2 — CID 135974067
2-hydroxy-3,6-dithiophen-2-yl-1H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 135974067) has the molecular formula C14H8N2O2S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-hydroxy-3,6-dithiophen-2-yl-1H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | 2-hydroxy-3,6-dithiophen-2-yl-1H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 135974067 |
| Molecular Formula | C14H8N2O2S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-hydroxy-3,6-dithiophen-2-yl-1H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C1N=c2c(-c3cccs3)c(O)[nH]c2=C1c1cccs1 |
| InChI | InChI=1S/C14H8N2O2S2/c17-13-9(7-3-1-5-19-7)11-12(16-13)10(14(18)15-11)8-4-2-6-20-8/h1-6,15,18H |
| InChIKey | DVDWNGIXAFAZDA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |