C28H21N7O8S — CID 135991934
diamino 5-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylate (PubChem CID 135991934) has the molecular formula C28H21N7O8S and a molecular weight of 615.58 g/mol. Its IUPAC name is diamino 5-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylate.
| Compound Name | diamino 5-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135991934 |
| Molecular Formula | C28H21N7O8S |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | diamino 5-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]benzene-1,3-dicarboxylate |
| SMILES | NOC(=O)c1cc(/N=N/c2ccc(/N=N/c3c(OS(=O)O)cc4ccc(N)cc4c3O)c3ccccc23)cc(C(=O)ON)c1 |
| InChI | InChI=1S/C28H21N7O8S/c29-17-6-5-14-12-24(43-44(39)40)25(26(36)21(14)13-17)35-34-23-8-7-22(19-3-1-2-4-20(19)23)33-32-18-10-15(27(37)41-30)9-16(11-18)28(38)42-31/h1-13,36H,29-31H2,(H,39,40)/b33-32+,35-34+ |
| InChIKey | GKAAIICSRNDWTM-VPHDGDOJSA-N |
| XLogP | 5.69 |
| TPSA | 246.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|