C27H25N5O8S — CID 135597611
3-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]-2,5-diethoxyphenyl]diazenyl]benzoic acid (PubChem CID 135597611) has the molecular formula C27H25N5O8S and a molecular weight of 579.59 g/mol. Its IUPAC name is 3-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]-2,5-diethoxyphenyl]diazenyl]benzoic acid.
| Compound Name | 3-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]-2,5-diethoxyphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135597611 |
| Molecular Formula | C27H25N5O8S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 3-[[4-[(7-amino-1-hydroxy-3-sulfinooxynaphthalen-2-yl)diazenyl]-2,5-diethoxyphenyl]diazenyl]benzoic acid |
| SMILES | CCOc1cc(/N=N/c2c(OS(=O)O)cc3ccc(N)cc3c2O)c(OCC)cc1/N=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H25N5O8S/c1-3-38-22-14-21(23(39-4-2)13-20(22)30-29-18-7-5-6-16(10-18)27(34)35)31-32-25-24(40-41(36)37)11-15-8-9-17(28)12-19(15)26(25)33/h5-14,33H,3-4,28H2,1-2H3,(H,34,35)(H,36,37)/b30-29+,32-31+ |
| InChIKey | YZLCWIMHXIPBRY-PNBBGTCESA-N |
| XLogP | 6.97 |
| TPSA | 197.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|