C18H24N2O2 — CID 136545110
3-benzyl-4-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,4-diazepan-2-one (PubChem CID 136545110) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-benzyl-4-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,4-diazepan-2-one.
| Compound Name | 3-benzyl-4-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 136545110 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-benzyl-4-(3,4-dihydro-2H-pyran-2-ylmethyl)-1,4-diazepan-2-one |
| SMILES | O=C1NCCCN(CC2CCC=CO2)C1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c21-18-17(13-15-7-2-1-3-8-15)20(11-6-10-19-18)14-16-9-4-5-12-22-16/h1-3,5,7-8,12,16-17H,4,6,9-11,13-14H2,(H,19,21) |
| InChIKey | QIGXQISMUBCCLC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |