C30H23N5O6 — CID 136641468
9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-2-[(7,8,9-trihydroxybenzo[a]pyren-10-yl)amino]-1H-purin-6-one (PubChem CID 136641468) has the molecular formula C30H23N5O6 and a molecular weight of 549.54 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-2-[(7,8,9-trihydroxybenzo[a]pyren-10-yl)amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-2-[(7,8,9-trihydroxybenzo[a]pyren-10-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136641468 |
| Molecular Formula | C30H23N5O6 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-2-[(7,8,9-trihydroxybenzo[a]pyren-10-yl)amino]-1H-purin-6-one |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(Nc4c(O)c(O)c(O)c5cc6ccc7cccc8ccc(c45)c6c78)nc32)C[C@@H]1O |
| InChI | InChI=1S/C30H23N5O6/c1-12-18(36)10-19(41-12)35-11-31-24-28(35)33-30(34-29(24)40)32-23-22-16-8-7-14-4-2-3-13-5-6-15(21(16)20(13)14)9-17(22)25(37)27(39)26(23)38/h2-9,11-12,18-19,36-39H,10H2,1H3,(H2,32,33,34,40)/t12-,18+,19-/m1/s1 |
| InChIKey | KBXOAERZGIDUOI-ZUSMLRIVSA-N |
| XLogP | 4.70 |
| TPSA | 165.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|