C24H24Br2N4O4 — CID 136647148
4-[[2-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-naphthalen-2-ylamino]-N-methylbutanamide (PubChem CID 136647148) has the molecular formula C24H24Br2N4O4 and a molecular weight of 592.29 g/mol. Its IUPAC name is 4-[[2-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-naphthalen-2-ylamino]-N-methylbutanamide.
| Compound Name | 4-[[2-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-naphthalen-2-ylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 136647148 |
| Molecular Formula | C24H24Br2N4O4 |
| Molecular Weight | 592.29 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 4-[[2-[(2Z)-2-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-naphthalen-2-ylamino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCN(CC(=O)N/N=C\c1cc(Br)c(O)c(Br)c1O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H24Br2N4O4/c1-27-20(31)7-4-10-30(18-9-8-15-5-2-3-6-16(15)11-18)14-21(32)29-28-13-17-12-19(25)24(34)22(26)23(17)33/h2-3,5-6,8-9,11-13,33-34H,4,7,10,14H2,1H3,(H,27,31)(H,29,32)/b28-13- |
| InChIKey | YHNMGYQNTVNQJY-QDTIIGTASA-N |
| XLogP | 4.26 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|