C19H14Br2N2O3 — CID 137148358
N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 137148358) has the molecular formula C19H14Br2N2O3 and a molecular weight of 478.14 g/mol. Its IUPAC name is N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 137148358 |
| Molecular Formula | C19H14Br2N2O3 |
| Molecular Weight | 478.14 g/mol |
| Exact Mass | 475.94 |
| IUPAC Name | N-[(3,5-dibromo-2,4-dihydroxyphenyl)methylidene]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)/N=C/c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C19H14Br2N2O3/c20-15-8-13(18(25)17(21)19(15)26)9-23-16(24)10-22-14-6-5-11-3-1-2-4-12(11)7-14/h1-9,22,25-26H,10H2/b23-9+ |
| InChIKey | IVOPGLUYVFMDIC-NUGSKGIGSA-N |
| XLogP | 4.83 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.14 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|