C37H47N7O4 — CID 136660370
tert-butyl N-[[2,3-dihydro-1H-imidazo[2,1-e]pyrazol-7-yl-[2-(tritylamino)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamate (PubChem CID 136660370) has the molecular formula C37H47N7O4 and a molecular weight of 653.83 g/mol. Its IUPAC name is tert-butyl N-[[2,3-dihydro-1H-imidazo[2,1-e]pyrazol-7-yl-[2-(tritylamino)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamate.
| Compound Name | tert-butyl N-[[2,3-dihydro-1H-imidazo[2,1-e]pyrazol-7-yl-[2-(tritylamino)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamate |
|---|---|
| PubChem CID | 136660370 |
| Molecular Formula | C37H47N7O4 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | tert-butyl N-[[2,3-dihydro-1H-imidazo[2,1-e]pyrazol-7-yl-[2-(tritylamino)ethyl]amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(NC(=O)OC(C)(C)C)N(CCNC(c1ccccc1)(c1ccccc1)c1ccccc1)c1cnn2c1NCC2 |
| InChI | InChI=1S/C37H47N7O4/c1-35(2,3)47-33(45)41-32(42-34(46)48-36(4,5)6)43(30-26-40-44-25-22-38-31(30)44)24-23-39-37(27-16-10-7-11-17-27,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,26,32,38-39H,22-25H2,1-6H3,(H,41,45)(H,42,46) |
| InChIKey | BTVWJJHKCKHWFY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|