C19H18N2OS2 — CID 136683291
4-methyl-2,6-bis(thiophen-2-ylmethyliminomethyl)phenol (PubChem CID 136683291) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-methyl-2,6-bis(thiophen-2-ylmethyliminomethyl)phenol.
| Compound Name | 4-methyl-2,6-bis(thiophen-2-ylmethyliminomethyl)phenol |
|---|---|
| PubChem CID | 136683291 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-methyl-2,6-bis(thiophen-2-ylmethyliminomethyl)phenol |
| SMILES | Cc1cc(/C=N/Cc2cccs2)c(O)c(/C=N/Cc2cccs2)c1 |
| InChI | InChI=1S/C19H18N2OS2/c1-14-8-15(10-20-12-17-4-2-6-23-17)19(22)16(9-14)11-21-13-18-5-3-7-24-18/h2-11,22H,12-13H2,1H3/b20-10+,21-11+ |
| InChIKey | JRJUXVREAZHQQA-CLVAPQHMSA-N |
| XLogP | 5.06 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|