C37H40FN3O4 — CID 136726185
[4-[(4-fluorophenyl)diazenyl]phenyl] 3-[(4-decoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzoate (PubChem CID 136726185) has the molecular formula C37H40FN3O4 and a molecular weight of 609.74 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)diazenyl]phenyl] 3-[(4-decoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzoate.
| Compound Name | [4-[(4-fluorophenyl)diazenyl]phenyl] 3-[(4-decoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 136726185 |
| Molecular Formula | C37H40FN3O4 |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | [4-[(4-fluorophenyl)diazenyl]phenyl] 3-[(4-decoxy-2-hydroxyphenyl)methylideneamino]-2-methylbenzoate |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2cccc(C(=O)Oc3ccc(/N=N/c4ccc(F)cc4)cc3)c2C)c(O)c1 |
| InChI | InChI=1S/C37H40FN3O4/c1-3-4-5-6-7-8-9-10-24-44-33-21-14-28(36(42)25-33)26-39-35-13-11-12-34(27(35)2)37(43)45-32-22-19-31(20-23-32)41-40-30-17-15-29(38)16-18-30/h11-23,25-26,42H,3-10,24H2,1-2H3/b39-26+,41-40+ |
| InChIKey | LSMZDYIAFRWJDT-ODCPPLRGSA-N |
| XLogP | 10.74 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|