C33H30N4O4 — CID 136683295
[4-[(4-cyanophenyl)diazenyl]phenyl] 3-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]-2-methylbenzoate (PubChem CID 136683295) has the molecular formula C33H30N4O4 and a molecular weight of 546.63 g/mol. Its IUPAC name is [4-[(4-cyanophenyl)diazenyl]phenyl] 3-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]-2-methylbenzoate.
| Compound Name | [4-[(4-cyanophenyl)diazenyl]phenyl] 3-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 136683295 |
| Molecular Formula | C33H30N4O4 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [4-[(4-cyanophenyl)diazenyl]phenyl] 3-[(2-hydroxy-4-pentoxyphenyl)methylideneamino]-2-methylbenzoate |
| SMILES | CCCCCOc1ccc(/C=N/c2cccc(C(=O)Oc3ccc(/N=N/c4ccc(C#N)cc4)cc3)c2C)c(O)c1 |
| InChI | InChI=1S/C33H30N4O4/c1-3-4-5-19-40-29-16-11-25(32(38)20-29)22-35-31-8-6-7-30(23(31)2)33(39)41-28-17-14-27(15-18-28)37-36-26-12-9-24(21-34)10-13-26/h6-18,20,22,38H,3-5,19H2,1-2H3/b35-22+,37-36+ |
| InChIKey | GGXYIGAWOUOQGS-LXRZZENLSA-N |
| XLogP | 8.53 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|