C31H25ClN2O4 — CID 136694867
[4-(4-cyanophenyl)phenyl] 3-[(4-butoxy-2-hydroxyphenyl)methylideneamino]-2-chlorobenzoate (PubChem CID 136694867) has the molecular formula C31H25ClN2O4 and a molecular weight of 525.00 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 3-[(4-butoxy-2-hydroxyphenyl)methylideneamino]-2-chlorobenzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 3-[(4-butoxy-2-hydroxyphenyl)methylideneamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 136694867 |
| Molecular Formula | C31H25ClN2O4 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 3-[(4-butoxy-2-hydroxyphenyl)methylideneamino]-2-chlorobenzoate |
| SMILES | CCCCOc1ccc(/C=N/c2cccc(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)c2Cl)c(O)c1 |
| InChI | InChI=1S/C31H25ClN2O4/c1-2-3-17-37-26-16-13-24(29(35)18-26)20-34-28-6-4-5-27(30(28)32)31(36)38-25-14-11-23(12-15-25)22-9-7-21(19-33)8-10-22/h4-16,18,20,35H,2-3,17H2,1H3/b34-20+ |
| InChIKey | FJJRPPCDHLUGSF-QXUDOOCXSA-N |
| XLogP | 7.73 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|