C24H24N2O8S2 — CID 136731934
4-hydroxy-3-[[2-[(2-hydroxy-3-methyl-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-5-methylbenzenesulfonic acid (PubChem CID 136731934) has the molecular formula C24H24N2O8S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-[(2-hydroxy-3-methyl-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-5-methylbenzenesulfonic acid.
| Compound Name | 4-hydroxy-3-[[2-[(2-hydroxy-3-methyl-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 136731934 |
| Molecular Formula | C24H24N2O8S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 4-hydroxy-3-[[2-[(2-hydroxy-3-methyl-5-sulfophenyl)methylideneamino]-4,5-dimethylphenyl]iminomethyl]-5-methylbenzenesulfonic acid |
| SMILES | Cc1cc(/N=C/c2cc(S(=O)(=O)O)cc(C)c2O)c(/N=C/c2cc(S(=O)(=O)O)cc(C)c2O)cc1C |
| InChI | InChI=1S/C24H24N2O8S2/c1-13-7-21(25-11-17-9-19(35(29,30)31)5-15(3)23(17)27)22(8-14(13)2)26-12-18-10-20(36(32,33)34)6-16(4)24(18)28/h5-12,27-28H,1-4H3,(H,29,30,31)(H,32,33,34)/b25-11+,26-12+ |
| InChIKey | SCJVNOGBQQDOOY-KOZSXFMUSA-N |
| XLogP | 4.33 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|