C49H40N4 — CID 136748858
24-[(2S)-2-methylbutyl]-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene (PubChem CID 136748858) has the molecular formula C49H40N4 and a molecular weight of 684.89 g/mol. Its IUPAC name is 24-[(2S)-2-methylbutyl]-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene.
| Compound Name | 24-[(2S)-2-methylbutyl]-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 136748858 |
| Molecular Formula | C49H40N4 |
| Molecular Weight | 684.89 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 24-[(2S)-2-methylbutyl]-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
| SMILES | CC[C@H](C)CC1C2=CN=C1/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)C1=N/C(=C\2c2ccccc2)C=C1 |
| InChI | InChI=1S/C49H40N4/c1-3-32(2)30-37-38-31-50-49(37)48(36-22-14-7-15-23-36)44-29-28-43(53-44)47(35-20-12-6-13-21-35)42-27-26-41(52-42)46(34-18-10-5-11-19-34)40-25-24-39(51-40)45(38)33-16-8-4-9-17-33/h4-29,31-32,37,52H,3,30H2,1-2H3/b45-38-,45-39-,46-40-,46-41-,47-42-,47-43-,48-44-,49-48+/t32-,37?/m0/s1 |
| InChIKey | KARPIYKOIHQGRU-MKZZKOGBSA-N |
| XLogP | 9.66 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.89 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |