About methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate
methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate (PubChem CID 136801608) has the molecular formula C16H18Cl2N2OS2
and a molecular weight of 389.37 g/mol. Its IUPAC name is methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate.
Molecular Properties
| Compound Name | methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate |
| PubChem CID | 136801608 |
| Molecular Formula | C16H18Cl2N2OS2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate |
| SMILES | CSC(=S)C1=C(NCC/N=C/c2cc(Cl)cc(Cl)c2O)CCC1 |
| InChI | InChI=1S/C16H18Cl2N2OS2/c1-23-16(22)12-3-2-4-14(12)20-6-5-19-9-10-7-11(17)8-13(18)15(10)21/h7-9,20-21H,2-6H2,1H3/b19-9+ |
| InChIKey | PPDJALYYSKRGFE-DJKKODMXSA-N |
| XLogP | 4.84 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate?
The IUPAC name of methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate (CID 136801608) is methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate.
What is the SMILES notation for methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate?
The canonical SMILES for methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate is CSC(=S)C1=C(NCC/N=C/c2cc(Cl)cc(Cl)c2O)CCC1.
What is the InChIKey of methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate?
The InChIKey is PPDJALYYSKRGFE-DJKKODMXSA-N. The full InChI is InChI=1S/C16H18Cl2N2OS2/c1-23-16(22)12-3-2-4-14(12)20-6-5-19-9-10-7-11(17)8-13(18)15(10)21/h7-9,20-21H,2-6H2,1H3/b19-9+.
What are the key properties of methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate?
methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate has a molecular weight of 389.37 g/mol, XLogP of 4.84, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]ethylamino]cyclopentene-1-carbodithioate is sourced from PubChem (CID 136801608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).