C9H9N5O3 — CID 136845144
(9-oxo-1,5,6,7-tetrahydroimidazo[1,2-a]purin-7-yl) acetate (PubChem CID 136845144) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is (9-oxo-1,5,6,7-tetrahydroimidazo[1,2-a]purin-7-yl) acetate.
| Compound Name | (9-oxo-1,5,6,7-tetrahydroimidazo[1,2-a]purin-7-yl) acetate |
|---|---|
| PubChem CID | 136845144 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (9-oxo-1,5,6,7-tetrahydroimidazo[1,2-a]purin-7-yl) acetate |
| SMILES | CC(=O)OC1CNc2nc3nc[nH]c3c(=O)n21 |
| InChI | InChI=1S/C9H9N5O3/c1-4(15)17-5-2-10-9-13-7-6(11-3-12-7)8(16)14(5)9/h3,5H,2H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | ISXUVCDMHJXLAO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |