C12H7F2N3O — CID 137081615
3-amino-7,8-difluorophenazin-2-ol (PubChem CID 137081615) has the molecular formula C12H7F2N3O and a molecular weight of 247.20 g/mol. Its IUPAC name is 3-amino-7,8-difluorophenazin-2-ol.
| Compound Name | 3-amino-7,8-difluorophenazin-2-ol |
|---|---|
| PubChem CID | 137081615 |
| Molecular Formula | C12H7F2N3O |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-amino-7,8-difluorophenazin-2-ol |
| SMILES | Nc1cc2nc3cc(F)c(F)cc3nc2cc1O |
| InChI | InChI=1S/C12H7F2N3O/c13-5-1-8-9(2-6(5)14)17-11-4-12(18)7(15)3-10(11)16-8/h1-4,18H,15H2 |
| InChIKey | UNCLWXAVWOMJOZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|