C12H11N3O — CID 142304830
3-amino-7,8-dihydrophenazin-2-ol (PubChem CID 142304830) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 3-amino-7,8-dihydrophenazin-2-ol.
| Compound Name | 3-amino-7,8-dihydrophenazin-2-ol |
|---|---|
| PubChem CID | 142304830 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-amino-7,8-dihydrophenazin-2-ol |
| SMILES | Nc1cc2nc3c(nc2cc1O)=CCCC=3 |
| InChI | InChI=1S/C12H11N3O/c13-7-5-10-11(6-12(7)16)15-9-4-2-1-3-8(9)14-10/h3-6,16H,1-2,13H2 |
| InChIKey | RGHCGXZQVJGEDH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|