C24H31N7 — CID 137167669
N-[3-[(7-ethyl-4-imino-2,3-dimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 137167669) has the molecular formula C24H31N7 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[3-[(7-ethyl-4-imino-2,3-dimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-[(7-ethyl-4-imino-2,3-dimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 137167669 |
| Molecular Formula | C24H31N7 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[3-[(7-ethyl-4-imino-2,3-dimethyl-1H-indol-5-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | [H]/N=C1C(=N\c2c(NCCCN(C)C)nn3ccccc23)\C=C(CC)c2[nH]c(C)c(C)c2\1 |
| InChI | InChI=1S/C24H31N7/c1-6-17-14-18(21(25)20-15(2)16(3)27-22(17)20)28-23-19-10-7-8-13-31(19)29-24(23)26-11-9-12-30(4)5/h7-8,10,13-14,25,27H,6,9,11-12H2,1-5H3,(H,26,29)/b25-21+,28-18+ |
| InChIKey | KDCJCSOKSGDECD-BQUOOXEASA-N |
| XLogP | 4.59 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|