C21H18N4O5 — CID 137191324
6-(2-aminoethylcarbamoyl)-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylic acid (PubChem CID 137191324) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 6-(2-aminoethylcarbamoyl)-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylic acid.
| Compound Name | 6-(2-aminoethylcarbamoyl)-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylic acid |
|---|---|
| PubChem CID | 137191324 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-(2-aminoethylcarbamoyl)-5-hydroxy-10-methoxybenzo[a]phenazine-9-carboxylic acid |
| SMILES | COc1cc2nc3c(nc2cc1C(=O)O)c(C(=O)NCCN)c(O)c1ccccc13 |
| InChI | InChI=1S/C21H18N4O5/c1-30-15-9-14-13(8-12(15)21(28)29)25-18-16(20(27)23-7-6-22)19(26)11-5-3-2-4-10(11)17(18)24-14/h2-5,8-9,26H,6-7,22H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | UEDRXICNHXYLQB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|