C8H8N4O — CID 137196393
3-diazenyl-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-ol (PubChem CID 137196393) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 3-diazenyl-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-ol.
| Compound Name | 3-diazenyl-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-ol |
|---|---|
| PubChem CID | 137196393 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-diazenyl-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-ol |
| SMILES | [H]/N=N/c1c(O)[nH]c2ncc(C)cc12 |
| InChI | InChI=1S/C8H8N4O/c1-4-2-5-6(12-9)8(13)11-7(5)10-3-4/h2-3,9,13H,1H3,(H,10,11)/b12-9+ |
| InChIKey | UKFLFDIQLHXFSM-FMIVXFBMSA-N |
| XLogP | 2.24 |
| TPSA | 85.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|