C11H13Cl2NO2S — CID 137247694
(NE,R)-N-[(2,3-dichloro-6-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 137247694) has the molecular formula C11H13Cl2NO2S and a molecular weight of 294.20 g/mol. Its IUPAC name is (NE,R)-N-[(2,3-dichloro-6-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[(2,3-dichloro-6-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 137247694 |
| Molecular Formula | C11H13Cl2NO2S |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | (NE,R)-N-[(2,3-dichloro-6-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1c(O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO2S/c1-11(2,3)17(16)14-6-7-9(15)5-4-8(12)10(7)13/h4-6,15H,1-3H3/b14-6+/t17-/m1/s1 |
| InChIKey | STEFRUFXPUYLKD-VNOAQLAMSA-N |
| XLogP | 3.58 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|