C48H37N3O — CID 137275912
24-methyl-12,17-bis(4-methylphenyl)-2,7-diphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ol (PubChem CID 137275912) has the molecular formula C48H37N3O and a molecular weight of 671.84 g/mol. Its IUPAC name is 24-methyl-12,17-bis(4-methylphenyl)-2,7-diphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ol.
| Compound Name | 24-methyl-12,17-bis(4-methylphenyl)-2,7-diphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ol |
|---|---|
| PubChem CID | 137275912 |
| Molecular Formula | C48H37N3O |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.29 |
| IUPAC Name | 24-methyl-12,17-bis(4-methylphenyl)-2,7-diphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-4-ol |
| SMILES | Cc1ccc(/C2=c3\cc/c([nH]3)=C(\c3ccc(C)cc3)C3=N/C(=C(/c4ccccc4)C4=C(O)C=C(/C(c5ccccc5)=C5/C=CC2=N5)C4C)C=C3)cc1 |
| InChI | InChI=1S/C48H37N3O/c1-29-14-18-34(19-15-29)46-38-23-22-37(49-38)45(32-10-6-4-7-11-32)36-28-43(52)44(31(36)3)48(33-12-8-5-9-13-33)42-27-26-41(51-42)47(40-25-24-39(46)50-40)35-20-16-30(2)17-21-35/h4-28,31,50,52H,1-3H3/b45-36-,45-37-,46-38-,46-39-,47-40-,47-41-,48-42-,48-44+ |
| InChIKey | WZWFFKYFLVQCGQ-IOBPIXQGSA-N |
| XLogP | 9.28 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |