C9H10O2 — CID 137309834
(Z)-4-cyclopenta-1,4-dien-1-yl-4-hydroxybut-3-en-2-one (PubChem CID 137309834) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (Z)-4-cyclopenta-1,4-dien-1-yl-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-4-cyclopenta-1,4-dien-1-yl-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 137309834 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (Z)-4-cyclopenta-1,4-dien-1-yl-4-hydroxybut-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)C1=CCC=C1 |
| InChI | InChI=1S/C9H10O2/c1-7(10)6-9(11)8-4-2-3-5-8/h2,4-6,11H,3H2,1H3/b9-6- |
| InChIKey | LGCRJEDYBOJPFO-TWGQIWQCSA-N |
| XLogP | 1.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|