C14H16N2O3 — CID 137317036
4-propyliminospiro[1,3-oxazolidine-5,4'-2,3-dihydrochromene]-2-one (PubChem CID 137317036) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-propyliminospiro[1,3-oxazolidine-5,4'-2,3-dihydrochromene]-2-one.
| Compound Name | 4-propyliminospiro[1,3-oxazolidine-5,4'-2,3-dihydrochromene]-2-one |
|---|---|
| PubChem CID | 137317036 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-propyliminospiro[1,3-oxazolidine-5,4'-2,3-dihydrochromene]-2-one |
| SMILES | CCC/N=C1\NC(=O)OC12CCOc1ccccc12 |
| InChI | InChI=1S/C14H16N2O3/c1-2-8-15-12-14(19-13(17)16-12)7-9-18-11-6-4-3-5-10(11)14/h3-6H,2,7-9H2,1H3,(H,15,16,17) |
| InChIKey | XWLLLPNUYPPGFI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|