C13H13BrN2O3S — CID 137348614
methyl (2Z)-3-amino-2-[3-(4-bromophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]propanoate (PubChem CID 137348614) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is methyl (2Z)-3-amino-2-[3-(4-bromophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]propanoate.
| Compound Name | methyl (2Z)-3-amino-2-[3-(4-bromophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]propanoate |
|---|---|
| PubChem CID | 137348614 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | methyl (2Z)-3-amino-2-[3-(4-bromophenyl)-4-oxo-1,3-thiazolidin-2-ylidene]propanoate |
| SMILES | COC(=O)/C(CN)=C1\SCC(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-19-13(18)10(6-15)12-16(11(17)7-20-12)9-4-2-8(14)3-5-9/h2-5H,6-7,15H2,1H3/b12-10- |
| InChIKey | UEDYOLMWFOHHRV-BENRWUELSA-N |
| XLogP | 1.87 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|