C17H28N2 — CID 137383651
N-[(4Z,6Z)-2,9-dimethyl-2-propyldeca-4,6,8-trienylidene]-N'-methylmethanimidamide (PubChem CID 137383651) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[(4Z,6Z)-2,9-dimethyl-2-propyldeca-4,6,8-trienylidene]-N'-methylmethanimidamide.
| Compound Name | N-[(4Z,6Z)-2,9-dimethyl-2-propyldeca-4,6,8-trienylidene]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 137383651 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[(4Z,6Z)-2,9-dimethyl-2-propyldeca-4,6,8-trienylidene]-N'-methylmethanimidamide |
| SMILES | CCCC(C)(/C=N/C=N/C)C/C=C\C=C/C=C(C)C |
| InChI | InChI=1S/C17H28N2/c1-6-12-17(4,14-19-15-18-5)13-10-8-7-9-11-16(2)3/h7-11,14-15H,6,12-13H2,1-5H3/b9-7-,10-8-,18-15+,19-14+ |
| InChIKey | HPTNDSGPVNCBRY-OZPLDTJXSA-N |
| XLogP | 4.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|