C32H32N6O2 — CID 137426040
(11R,16S)-5-anilino-3-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,9-trien-7-one (PubChem CID 137426040) has the molecular formula C32H32N6O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is (11R,16S)-5-anilino-3-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,9-trien-7-one.
| Compound Name | (11R,16S)-5-anilino-3-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,9-trien-7-one |
|---|---|
| PubChem CID | 137426040 |
| Molecular Formula | C32H32N6O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (11R,16S)-5-anilino-3-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,9-trien-7-one |
| SMILES | CN1C(=O)c2c(Nc3ccccc3)nn(Cc3ccc(C(O)c4ccccc4)cc3)c2N2C1=N[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C32H32N6O2/c1-36-31(40)27-29(33-24-12-6-3-7-13-24)35-37(30(27)38-26-15-9-8-14-25(26)34-32(36)38)20-21-16-18-23(19-17-21)28(39)22-10-4-2-5-11-22/h2-7,10-13,16-19,25-26,28,39H,8-9,14-15,20H2,1H3,(H,33,35)/t25-,26+,28?/m1/s1 |
| InChIKey | VAVXDXHTBKMHKS-OQKNHUCHSA-N |
| XLogP | 5.33 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |