C19H27F3O6 — CID 137432159
[2-oxo-2-(6,6,6-trifluorohexoxy)ethyl] 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 137432159) has the molecular formula C19H27F3O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-oxo-2-(6,6,6-trifluorohexoxy)ethyl] 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | [2-oxo-2-(6,6,6-trifluorohexoxy)ethyl] 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 137432159 |
| Molecular Formula | C19H27F3O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-oxo-2-(6,6,6-trifluorohexoxy)ethyl] 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OCC(=O)OCCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H27F3O6/c1-13(2)17(24)28-15-8-6-14(7-9-15)18(25)27-12-16(23)26-11-5-3-4-10-19(20,21)22/h14-15H,1,3-12H2,2H3 |
| InChIKey | KIYRUBWFBXDHKL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|