C18H27N — CID 137439718
1-[(7S)-6-butan-2-yl-3,4-dimethyl-2-bicyclo[5.2.0]nona-2,5,8-trienyl]-N-methylethanimine (PubChem CID 137439718) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-[(7S)-6-butan-2-yl-3,4-dimethyl-2-bicyclo[5.2.0]nona-2,5,8-trienyl]-N-methylethanimine.
| Compound Name | 1-[(7S)-6-butan-2-yl-3,4-dimethyl-2-bicyclo[5.2.0]nona-2,5,8-trienyl]-N-methylethanimine |
|---|---|
| PubChem CID | 137439718 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-[(7S)-6-butan-2-yl-3,4-dimethyl-2-bicyclo[5.2.0]nona-2,5,8-trienyl]-N-methylethanimine |
| SMILES | CCC(C)C1=CC(C)C(C)=C(/C(C)=N/C)C2C=C[C@H]12 |
| InChI | InChI=1S/C18H27N/c1-7-11(2)17-10-12(3)13(4)18(14(5)19-6)16-9-8-15(16)17/h8-12,15-16H,7H2,1-6H3/b19-14+/t11?,12?,15-,16?/m0/s1 |
| InChIKey | RQJAJGIBRPHNJC-XHTXIFLCSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|