C28H16N4O9S2 — CID 138455515
4-[[4-(4-nitrobenzoyl)-1',2,3'-trioxospiro[furan-5,2'-indene]-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 138455515) has the molecular formula C28H16N4O9S2 and a molecular weight of 616.59 g/mol. Its IUPAC name is 4-[[4-(4-nitrobenzoyl)-1',2,3'-trioxospiro[furan-5,2'-indene]-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[4-(4-nitrobenzoyl)-1',2,3'-trioxospiro[furan-5,2'-indene]-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 138455515 |
| Molecular Formula | C28H16N4O9S2 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.04 |
| IUPAC Name | 4-[[4-(4-nitrobenzoyl)-1',2,3'-trioxospiro[furan-5,2'-indene]-3-yl]amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=C1OC2(C(=O)c3ccccc3C2=O)C(C(=O)c2ccc([N+](=O)[O-])cc2)=C1Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C28H16N4O9S2/c33-23(15-5-9-17(10-6-15)32(37)38)21-22(26(36)41-28(21)24(34)19-3-1-2-4-20(19)25(28)35)30-16-7-11-18(12-8-16)43(39,40)31-27-29-13-14-42-27/h1-14,30H,(H,29,31) |
| InChIKey | DRNBMNNWTOOOOE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 191.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|