C11H12N2O4 — CID 138460735
3-(5-hydroxy-1-methyl-2-oxo-3-pyridinyl)piperidine-2,6-dione (PubChem CID 138460735) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-(5-hydroxy-1-methyl-2-oxo-3-pyridinyl)piperidine-2,6-dione.
| Compound Name | 3-(5-hydroxy-1-methyl-2-oxo-3-pyridinyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 138460735 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-(5-hydroxy-1-methyl-2-oxo-3-pyridinyl)piperidine-2,6-dione |
| SMILES | Cn1cc(O)cc(C2CCC(=O)NC2=O)c1=O |
| InChI | InChI=1S/C11H12N2O4/c1-13-5-6(14)4-8(11(13)17)7-2-3-9(15)12-10(7)16/h4-5,7,14H,2-3H2,1H3,(H,12,15,16) |
| InChIKey | PKLXBYNDKYBZMS-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|