C28H18F10 — CID 138468601
6-[2-[2,6-difluoro-4-(2-fluoro-4-methylcyclohex-2-en-1-yl)phenyl]-2,2-difluoroethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138468601) has the molecular formula C28H18F10 and a molecular weight of 544.43 g/mol. Its IUPAC name is 6-[2-[2,6-difluoro-4-(2-fluoro-4-methylcyclohex-2-en-1-yl)phenyl]-2,2-difluoroethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[2-[2,6-difluoro-4-(2-fluoro-4-methylcyclohex-2-en-1-yl)phenyl]-2,2-difluoroethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138468601 |
| Molecular Formula | C28H18F10 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 6-[2-[2,6-difluoro-4-(2-fluoro-4-methylcyclohex-2-en-1-yl)phenyl]-2,2-difluoroethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | CC1C=C(F)C(c2cc(F)c(C(F)(F)Cc3ccc4c(F)c(C#CC(F)(F)F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H18F10/c1-14-2-4-18(21(29)8-14)17-11-23(31)25(24(32)12-17)27(34,35)13-15-3-5-19-16(9-15)10-22(30)20(26(19)33)6-7-28(36,37)38/h3,5,8-12,14,18H,2,4,13H2,1H3 |
| InChIKey | BWGXDCSVKITQLY-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|