C81H66O9P4 — CID 138488514
tris[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxymethyl]phosphane (PubChem CID 138488514) has the molecular formula C81H66O9P4 and a molecular weight of 1307.31 g/mol. Its IUPAC name is tris[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxymethyl]phosphane.
| Compound Name | tris[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxymethyl]phosphane |
|---|---|
| PubChem CID | 138488514 |
| Molecular Formula | C81H66O9P4 |
| Molecular Weight | 1307.31 g/mol |
| Exact Mass | 1306.37 |
| IUPAC Name | tris[(4,4,5,5-tetraphenyl-1,3,2-dioxaphospholan-2-yl)oxymethyl]phosphane |
| SMILES | c1ccc(C2(c3ccccc3)OP(OCP(COP3OC(c4ccccc4)(c4ccccc4)C(c4ccccc4)(c4ccccc4)O3)COP3OC(c4ccccc4)(c4ccccc4)C(c4ccccc4)(c4ccccc4)O3)OC2(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C81H66O9P4/c1-13-37-64(38-14-1)76(65-39-15-2-16-40-65)77(66-41-17-3-18-42-66,67-43-19-4-20-44-67)86-92(85-76)82-61-91(62-83-93-87-78(68-45-21-5-22-46-68,69-47-23-6-24-48-69)79(88-93,70-49-25-7-26-50-70)71-51-27-8-28-52-71)63-84-94-89-80(72-53-29-9-30-54-72,73-55-31-10-32-56-73)81(90-94,74-57-33-11-34-58-74)75-59-35-12-36-60-75/h1-60H,61-63H2 |
| InChIKey | PZHZHSWGJKGULY-UHFFFAOYSA-N |
| XLogP | 20.87 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1307.31 |
| LogP ≤ 5 | 20.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|