C37H30N4S — CID 138500752
2-[[7,7-dimethyl-10-(4-phenyl-N-(3,4,5-trimethylphenyl)anilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]propanedinitrile (PubChem CID 138500752) has the molecular formula C37H30N4S and a molecular weight of 562.74 g/mol. Its IUPAC name is 2-[[7,7-dimethyl-10-(4-phenyl-N-(3,4,5-trimethylphenyl)anilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[7,7-dimethyl-10-(4-phenyl-N-(3,4,5-trimethylphenyl)anilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 138500752 |
| Molecular Formula | C37H30N4S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-[[7,7-dimethyl-10-(4-phenyl-N-(3,4,5-trimethylphenyl)anilino)-3-thia-12-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-4-yl]methylidene]propanedinitrile |
| SMILES | Cc1cc(N(c2ccc(-c3ccccc3)cc2)c2cnc3c(c2)C(C)(C)c2cc(C=C(C#N)C#N)sc2-3)cc(C)c1C |
| InChI | InChI=1S/C37H30N4S/c1-23-15-30(16-24(2)25(23)3)41(29-13-11-28(12-14-29)27-9-7-6-8-10-27)31-18-33-35(40-22-31)36-34(37(33,4)5)19-32(42-36)17-26(20-38)21-39/h6-19,22H,1-5H3 |
| InChIKey | FHAWFDRPOMUJMA-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|