C30H34F4 — CID 138511411
2-cyclohexyl-3,4,5,6-tetrafluoro-7-[4-[(E)-pent-3-enyl]cyclohexyl]-9H-fluorene (PubChem CID 138511411) has the molecular formula C30H34F4 and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-cyclohexyl-3,4,5,6-tetrafluoro-7-[4-[(E)-pent-3-enyl]cyclohexyl]-9H-fluorene.
| Compound Name | 2-cyclohexyl-3,4,5,6-tetrafluoro-7-[4-[(E)-pent-3-enyl]cyclohexyl]-9H-fluorene |
|---|---|
| PubChem CID | 138511411 |
| Molecular Formula | C30H34F4 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-cyclohexyl-3,4,5,6-tetrafluoro-7-[4-[(E)-pent-3-enyl]cyclohexyl]-9H-fluorene |
| SMILES | C/C=C/CCC1CCC(c2cc3c(c(F)c2F)-c2c(cc(C4CCCCC4)c(F)c2F)C3)CC1 |
| InChI | InChI=1S/C30H34F4/c1-2-3-5-8-18-11-13-20(14-12-18)24-17-22-15-21-16-23(19-9-6-4-7-10-19)27(31)29(33)25(21)26(22)30(34)28(24)32/h2-3,16-20H,4-15H2,1H3/b3-2+ |
| InChIKey | GFRUFNVTYOUEAK-NSCUHMNNSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|