C12H8IN5S — CID 138541437
2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-6-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 138541437) has the molecular formula C12H8IN5S and a molecular weight of 381.20 g/mol. Its IUPAC name is 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-6-methylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-6-methylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 138541437 |
| Molecular Formula | C12H8IN5S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-6-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1cn2nc(-c3ccn4c(I)cnc4c3)sc2n1 |
| InChI | InChI=1S/C12H8IN5S/c1-7-6-18-12(15-7)19-11(16-18)8-2-3-17-9(13)5-14-10(17)4-8/h2-6H,1H3 |
| InChIKey | RLEHRNKUVMOVMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|