C28H23ClF3N3O8 — CID 138556188
ethyl 8-chloro-1-[5-[(2,4-dimethoxyphenyl)methylamino]-4-fluoro-2-(hydroxymethyl)phenyl]-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 138556188) has the molecular formula C28H23ClF3N3O8 and a molecular weight of 621.95 g/mol. Its IUPAC name is ethyl 8-chloro-1-[5-[(2,4-dimethoxyphenyl)methylamino]-4-fluoro-2-(hydroxymethyl)phenyl]-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-1-[5-[(2,4-dimethoxyphenyl)methylamino]-4-fluoro-2-(hydroxymethyl)phenyl]-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 138556188 |
| Molecular Formula | C28H23ClF3N3O8 |
| Molecular Weight | 621.95 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | ethyl 8-chloro-1-[5-[(2,4-dimethoxyphenyl)methylamino]-4-fluoro-2-(hydroxymethyl)phenyl]-6,7-difluoro-5-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2cc(NCc3ccc(OC)cc3OC)c(F)cc2CO)c2c(Cl)c(F)c(F)c([N+](=O)[O-])c2c1=O |
| InChI | InChI=1S/C28H23ClF3N3O8/c1-4-43-28(38)16-11-34(25-21(27(16)37)26(35(39)40)24(32)23(31)22(25)29)19-9-18(17(30)7-14(19)12-36)33-10-13-5-6-15(41-2)8-20(13)42-3/h5-9,11,33,36H,4,10,12H2,1-3H3 |
| InChIKey | CQLCEXMMYVDXOA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.95 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|