C37H45ClFN3 — CID 138662805
2-(5-chloro-2-fluorophenyl)-4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazine (PubChem CID 138662805) has the molecular formula C37H45ClFN3 and a molecular weight of 586.24 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 138662805 |
| Molecular Formula | C37H45ClFN3 |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-4,6-bis(3,5-ditert-butylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)nc(-c3cc(Cl)ccc3F)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H45ClFN3/c1-34(2,3)24-15-22(16-25(19-24)35(4,5)6)31-40-32(42-33(41-31)29-21-28(38)13-14-30(29)39)23-17-26(36(7,8)9)20-27(18-23)37(10,11)12/h13-21H,1-12H3 |
| InChIKey | QFHYJTJJQZCUCY-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |