C33H42O12 — CID 138677177
dimethyl 1,4-bis[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexa-2,5-diene-1,2-dicarboxylate (PubChem CID 138677177) has the molecular formula C33H42O12 and a molecular weight of 630.69 g/mol. Its IUPAC name is dimethyl 1,4-bis[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexa-2,5-diene-1,2-dicarboxylate.
| Compound Name | dimethyl 1,4-bis[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexa-2,5-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138677177 |
| Molecular Formula | C33H42O12 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | dimethyl 1,4-bis[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexa-2,5-diene-1,2-dicarboxylate |
| SMILES | COC(=O)/C=C(\C(=O)OC)C1(CC/C=C(\C)CCC=C(C)C)C=CC(C(=O)OC)(/C(=C/C(=O)OC)C(=O)OC)C(C(=O)OC)=C1 |
| InChI | InChI=1S/C33H42O12/c1-21(2)12-10-13-22(3)14-11-15-32(23(28(36)42-6)18-26(34)40-4)16-17-33(31(39)45-9,25(20-32)30(38)44-8)24(29(37)43-7)19-27(35)41-5/h12,14,16-20H,10-11,13,15H2,1-9H3/b22-14+,23-18+,24-19+ |
| InChIKey | OYHWJIBHQWZBCW-QAPBZUGOSA-N |
| XLogP | 3.82 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|