C7H8F4O4 — CID 138726518
[(E)-3-(2,2,3,3-tetrafluoropropoxy)prop-1-enyl] hydrogen carbonate (PubChem CID 138726518) has the molecular formula C7H8F4O4 and a molecular weight of 232.13 g/mol. Its IUPAC name is [(E)-3-(2,2,3,3-tetrafluoropropoxy)prop-1-enyl] hydrogen carbonate.
| Compound Name | [(E)-3-(2,2,3,3-tetrafluoropropoxy)prop-1-enyl] hydrogen carbonate |
|---|---|
| PubChem CID | 138726518 |
| Molecular Formula | C7H8F4O4 |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | [(E)-3-(2,2,3,3-tetrafluoropropoxy)prop-1-enyl] hydrogen carbonate |
| SMILES | O=C(O)O/C=C/COCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F4O4/c8-5(9)7(10,11)4-14-2-1-3-15-6(12)13/h1,3,5H,2,4H2,(H,12,13)/b3-1+ |
| InChIKey | SIEGXCOVMFQQSS-HNQUOIGGSA-N |
| XLogP | 2.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|