C16H36N2O2S — CID 138729250
S-[4-[2-(4-amino-2,4-dimethylpentan-2-yl)oxyethoxy]-2,4-dimethylpentan-2-yl]thiohydroxylamine (PubChem CID 138729250) has the molecular formula C16H36N2O2S and a molecular weight of 320.54 g/mol. Its IUPAC name is S-[4-[2-(4-amino-2,4-dimethylpentan-2-yl)oxyethoxy]-2,4-dimethylpentan-2-yl]thiohydroxylamine.
| Compound Name | S-[4-[2-(4-amino-2,4-dimethylpentan-2-yl)oxyethoxy]-2,4-dimethylpentan-2-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 138729250 |
| Molecular Formula | C16H36N2O2S |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | S-[4-[2-(4-amino-2,4-dimethylpentan-2-yl)oxyethoxy]-2,4-dimethylpentan-2-yl]thiohydroxylamine |
| SMILES | CC(C)(N)CC(C)(C)OCCOC(C)(C)CC(C)(C)SN |
| InChI | InChI=1S/C16H36N2O2S/c1-13(2,17)11-14(3,4)19-9-10-20-15(5,6)12-16(7,8)21-18/h9-12,17-18H2,1-8H3 |
| InChIKey | HVXCRUIBNWUKQE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|